C16H23N2OS+ — CID 5206714
3-tert-butyl-1-phenyl-2,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-3-ol (PubChem CID 5206714) has the molecular formula C16H23N2OS+ and a molecular weight of 291.44 g/mol. Its IUPAC name is 3-tert-butyl-1-phenyl-2,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-3-ol.
| Compound Name | 3-tert-butyl-1-phenyl-2,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-3-ol |
|---|---|
| PubChem CID | 5206714 |
| Molecular Formula | C16H23N2OS+ |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 3-tert-butyl-1-phenyl-2,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-3-ol |
| SMILES | CC(C)(C)C1(O)CN(c2ccccc2)C2=[N+]1CCCS2 |
| InChI | InChI=1S/C16H23N2OS/c1-15(2,3)16(19)12-17(13-8-5-4-6-9-13)14-18(16)10-7-11-20-14/h4-6,8-9,19H,7,10-12H2,1-3H3/q+1 |
| InChIKey | FERUFWIXUBTLBN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 26.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_imine_ium(2)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|