About 2-ethoxy-3-ethylpyrazine
2-ethoxy-3-ethylpyrazine (PubChem CID 520722) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is 2-ethoxy-3-ethylpyrazine.
Molecular Properties
| Compound Name | 2-ethoxy-3-ethylpyrazine |
| PubChem CID | 520722 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 2-ethoxy-3-ethylpyrazine |
| SMILES | CCOc1nccnc1CC |
| InChI | InChI=1S/C8H12N2O/c1-3-7-8(11-4-2)10-6-5-9-7/h5-6H,3-4H2,1-2H3 |
| InChIKey | TYSHGGVMHVIOMH-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethoxy-3-ethylpyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-3-ethylpyrazine?
The IUPAC name of 2-ethoxy-3-ethylpyrazine (CID 520722) is 2-ethoxy-3-ethylpyrazine.
What is the SMILES notation for 2-ethoxy-3-ethylpyrazine?
The canonical SMILES for 2-ethoxy-3-ethylpyrazine is CCOc1nccnc1CC.
What is the InChIKey of 2-ethoxy-3-ethylpyrazine?
The InChIKey is TYSHGGVMHVIOMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O/c1-3-7-8(11-4-2)10-6-5-9-7/h5-6H,3-4H2,1-2H3.
What are the key properties of 2-ethoxy-3-ethylpyrazine?
2-ethoxy-3-ethylpyrazine has a molecular weight of 152.20 g/mol, XLogP of 1.44, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-3-ethylpyrazine is sourced from PubChem (CID 520722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).