About 3-(2-amino-1,3-thiazol-4-yl)-8-ethoxychromen-2-one
3-(2-amino-1,3-thiazol-4-yl)-8-ethoxychromen-2-one (PubChem CID 5207452) has the molecular formula C14H12N2O3S
and a molecular weight of 288.33 g/mol. Its IUPAC name is 3-(2-amino-1,3-thiazol-4-yl)-8-ethoxychromen-2-one.
Molecular Properties
| Compound Name | 3-(2-amino-1,3-thiazol-4-yl)-8-ethoxychromen-2-one |
| PubChem CID | 5207452 |
| Molecular Formula | C14H12N2O3S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 3-(2-amino-1,3-thiazol-4-yl)-8-ethoxychromen-2-one |
| SMILES | CCOc1cccc2cc(-c3csc(N)n3)c(=O)oc12 |
| InChI | InChI=1S/C14H12N2O3S/c1-2-18-11-5-3-4-8-6-9(13(17)19-12(8)11)10-7-20-14(15)16-10/h3-7H,2H2,1H3,(H2,15,16) |
| InChIKey | TYVCMCDWOXCOEJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-amino-1,3-thiazol-4-yl)-8-ethoxychromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-amino-1,3-thiazol-4-yl)-8-ethoxychromen-2-one?
The IUPAC name of 3-(2-amino-1,3-thiazol-4-yl)-8-ethoxychromen-2-one (CID 5207452) is 3-(2-amino-1,3-thiazol-4-yl)-8-ethoxychromen-2-one.
What is the SMILES notation for 3-(2-amino-1,3-thiazol-4-yl)-8-ethoxychromen-2-one?
The canonical SMILES for 3-(2-amino-1,3-thiazol-4-yl)-8-ethoxychromen-2-one is CCOc1cccc2cc(-c3csc(N)n3)c(=O)oc12.
What is the InChIKey of 3-(2-amino-1,3-thiazol-4-yl)-8-ethoxychromen-2-one?
The InChIKey is TYVCMCDWOXCOEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O3S/c1-2-18-11-5-3-4-8-6-9(13(17)19-12(8)11)10-7-20-14(15)16-10/h3-7H,2H2,1H3,(H2,15,16).
What are the key properties of 3-(2-amino-1,3-thiazol-4-yl)-8-ethoxychromen-2-one?
3-(2-amino-1,3-thiazol-4-yl)-8-ethoxychromen-2-one has a molecular weight of 288.33 g/mol, XLogP of 2.90, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-amino-1,3-thiazol-4-yl)-8-ethoxychromen-2-one is sourced from PubChem (CID 5207452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).