About 1-isocyanato-2,4-dimethylbenzene
1-isocyanato-2,4-dimethylbenzene (PubChem CID 5207585) has the molecular formula C9H9NO
and a molecular weight of 147.18 g/mol. Its IUPAC name is 1-isocyanato-2,4-dimethylbenzene.
Molecular Properties
| Compound Name | 1-isocyanato-2,4-dimethylbenzene |
| PubChem CID | 5207585 |
| Molecular Formula | C9H9NO |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | 1-isocyanato-2,4-dimethylbenzene |
| SMILES | Cc1ccc(N=C=O)c(C)c1 |
| InChI | InChI=1S/C9H9NO/c1-7-3-4-9(10-6-11)8(2)5-7/h3-5H,1-2H3 |
| InChIKey | QUOBVYPFBJUOAJ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1-isocyanato-2,4-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-isocyanato-2,4-dimethylbenzene?
The IUPAC name of 1-isocyanato-2,4-dimethylbenzene (CID 5207585) is 1-isocyanato-2,4-dimethylbenzene.
What is the SMILES notation for 1-isocyanato-2,4-dimethylbenzene?
The canonical SMILES for 1-isocyanato-2,4-dimethylbenzene is Cc1ccc(N=C=O)c(C)c1.
What is the InChIKey of 1-isocyanato-2,4-dimethylbenzene?
The InChIKey is QUOBVYPFBJUOAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO/c1-7-3-4-9(10-6-11)8(2)5-7/h3-5H,1-2H3.
What are the key properties of 1-isocyanato-2,4-dimethylbenzene?
1-isocyanato-2,4-dimethylbenzene has a molecular weight of 147.18 g/mol, XLogP of 2.27, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-isocyanato-2,4-dimethylbenzene is sourced from PubChem (CID 5207585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).