C32H52O8 — CID 5208079
2-(hydroxymethyl)-6-[[17-[1-[5-(hydroxymethyl)oxolan-2-yl]ethyl]-1,13-dimethyl-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl]oxy]oxane-3,4,5-triol (PubChem CID 5208079) has the molecular formula C32H52O8 and a molecular weight of 564.76 g/mol. Its IUPAC name is 2-(hydroxymethyl)-6-[[17-[1-[5-(hydroxymethyl)oxolan-2-yl]ethyl]-1,13-dimethyl-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl]oxy]oxane-3,4,5-triol.
| Compound Name | 2-(hydroxymethyl)-6-[[17-[1-[5-(hydroxymethyl)oxolan-2-yl]ethyl]-1,13-dimethyl-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl]oxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 5208079 |
| Molecular Formula | C32H52O8 |
| Molecular Weight | 564.76 g/mol |
| Exact Mass | 564.37 |
| IUPAC Name | 2-(hydroxymethyl)-6-[[17-[1-[5-(hydroxymethyl)oxolan-2-yl]ethyl]-1,13-dimethyl-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl]oxy]oxane-3,4,5-triol |
| SMILES | CC1CC(OC2OC(CO)C(O)C(O)C2O)CC2=CCC3C(CCC4(C)C(C(C)C5CCC(CO)O5)CCC34)C21 |
| InChI | InChI=1S/C32H52O8/c1-16-12-20(39-31-30(37)29(36)28(35)26(15-34)40-31)13-18-4-6-21-22(27(16)18)10-11-32(3)23(7-8-24(21)32)17(2)25-9-5-19(14-33)38-25/h4,16-17,19-31,33-37H,5-15H2,1-3H3 |
| InChIKey | JIUUIMUTJSAZJM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 128.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.76 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|