C20H20F3NO6 — CID 5208246
2-methoxyethyl 2-amino-5-oxo-4-[4-(trifluoromethoxy)phenyl]-4,6,7,8-tetrahydrochromene-3-carboxylate (PubChem CID 5208246) has the molecular formula C20H20F3NO6 and a molecular weight of 427.38 g/mol. Its IUPAC name is 2-methoxyethyl 2-amino-5-oxo-4-[4-(trifluoromethoxy)phenyl]-4,6,7,8-tetrahydrochromene-3-carboxylate.
| Compound Name | 2-methoxyethyl 2-amino-5-oxo-4-[4-(trifluoromethoxy)phenyl]-4,6,7,8-tetrahydrochromene-3-carboxylate |
|---|---|
| PubChem CID | 5208246 |
| Molecular Formula | C20H20F3NO6 |
| Molecular Weight | 427.38 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 2-methoxyethyl 2-amino-5-oxo-4-[4-(trifluoromethoxy)phenyl]-4,6,7,8-tetrahydrochromene-3-carboxylate |
| SMILES | COCCOC(=O)C1=C(N)OC2=C(C(=O)CCC2)C1c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H20F3NO6/c1-27-9-10-28-19(26)17-15(11-5-7-12(8-6-11)30-20(21,22)23)16-13(25)3-2-4-14(16)29-18(17)24/h5-8,15H,2-4,9-10,24H2,1H3 |
| InChIKey | SOEYZCWDTJWEBN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|