C6H8N6 — CID 520838
(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)hydrazine (PubChem CID 520838) has the molecular formula C6H8N6 and a molecular weight of 164.17 g/mol. Its IUPAC name is (5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)hydrazine.
| Compound Name | (5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)hydrazine |
|---|---|
| PubChem CID | 520838 |
| Molecular Formula | C6H8N6 |
| Molecular Weight | 164.17 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | (5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)hydrazine |
| SMILES | Cc1cc(NN)n2ncnc2n1 |
| InChI | InChI=1S/C6H8N6/c1-4-2-5(11-7)12-6(10-4)8-3-9-12/h2-3,11H,7H2,1H3 |
| InChIKey | AMAXZVMYLDNQTL-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 81.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.17 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|