C9H24O4Si4 — CID 520858
2-ethenyl-2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 520858) has the molecular formula C9H24O4Si4 and a molecular weight of 308.63 g/mol. Its IUPAC name is 2-ethenyl-2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2-ethenyl-2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 520858 |
| Molecular Formula | C9H24O4Si4 |
| Molecular Weight | 308.63 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 2-ethenyl-2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | C=C[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1 |
| InChI | InChI=1S/C9H24O4Si4/c1-9-17(8)12-15(4,5)10-14(2,3)11-16(6,7)13-17/h9H,1H2,2-8H3 |
| InChIKey | LTIUDPOSFOYSKA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.63 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|