About 3,4-diethoxyaniline
3,4-diethoxyaniline (PubChem CID 520936) has the molecular formula C10H15NO2
and a molecular weight of 181.23 g/mol. Its IUPAC name is 3,4-diethoxyaniline.
Molecular Properties
| Compound Name | 3,4-diethoxyaniline |
| PubChem CID | 520936 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 3,4-diethoxyaniline |
| SMILES | CCOc1ccc(N)cc1OCC |
| InChI | InChI=1S/C10H15NO2/c1-3-12-9-6-5-8(11)7-10(9)13-4-2/h5-7H,3-4,11H2,1-2H3 |
| InChIKey | IKYZLUAAOLUOFW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3,4-diethoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diethoxyaniline?
The IUPAC name of 3,4-diethoxyaniline (CID 520936) is 3,4-diethoxyaniline.
What is the SMILES notation for 3,4-diethoxyaniline?
The canonical SMILES for 3,4-diethoxyaniline is CCOc1ccc(N)cc1OCC.
What is the InChIKey of 3,4-diethoxyaniline?
The InChIKey is IKYZLUAAOLUOFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO2/c1-3-12-9-6-5-8(11)7-10(9)13-4-2/h5-7H,3-4,11H2,1-2H3.
What are the key properties of 3,4-diethoxyaniline?
3,4-diethoxyaniline has a molecular weight of 181.23 g/mol, XLogP of 2.07, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diethoxyaniline is sourced from PubChem (CID 520936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).