About 2-deuteriooxypropane
2-deuteriooxypropane (PubChem CID 520960) has the molecular formula C3H8O
and a molecular weight of 61.10 g/mol. Its IUPAC name is 2-deuteriooxypropane.
Molecular Properties
| Compound Name | 2-deuteriooxypropane |
| PubChem CID | 520960 |
| Molecular Formula | C3H8O |
| Molecular Weight | 61.10 g/mol |
| Exact Mass | 61.06 |
| IUPAC Name | 2-deuteriooxypropane |
| SMILES | [2H]OC(C)C |
| InChI | InChI=1S/C3H8O/c1-3(2)4/h3-4H,1-2H3/i4D |
| InChIKey | KFZMGEQAYNKOFK-QYKNYGDISA-N |
| XLogP | 0.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 61.10 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-deuteriooxypropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-deuteriooxypropane?
The IUPAC name of 2-deuteriooxypropane (CID 520960) is 2-deuteriooxypropane.
What is the SMILES notation for 2-deuteriooxypropane?
The canonical SMILES for 2-deuteriooxypropane is [2H]OC(C)C.
What is the InChIKey of 2-deuteriooxypropane?
The InChIKey is KFZMGEQAYNKOFK-QYKNYGDISA-N. The full InChI is InChI=1S/C3H8O/c1-3(2)4/h3-4H,1-2H3/i4D.
What are the key properties of 2-deuteriooxypropane?
2-deuteriooxypropane has a molecular weight of 61.10 g/mol, XLogP of 0.39, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-deuteriooxypropane is sourced from PubChem (CID 520960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).