About N,N-diethyl-2,6-dimethylaniline
N,N-diethyl-2,6-dimethylaniline (PubChem CID 520973) has the molecular formula C12H19N
and a molecular weight of 177.29 g/mol. Its IUPAC name is N,N-diethyl-2,6-dimethylaniline.
Molecular Properties
| Compound Name | N,N-diethyl-2,6-dimethylaniline |
| PubChem CID | 520973 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | N,N-diethyl-2,6-dimethylaniline |
| SMILES | CCN(CC)c1c(C)cccc1C |
| InChI | InChI=1S/C12H19N/c1-5-13(6-2)12-10(3)8-7-9-11(12)4/h7-9H,5-6H2,1-4H3 |
| InChIKey | KECFTDQVRIBMCH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-diethyl-2,6-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-2,6-dimethylaniline?
The IUPAC name of N,N-diethyl-2,6-dimethylaniline (CID 520973) is N,N-diethyl-2,6-dimethylaniline.
What is the SMILES notation for N,N-diethyl-2,6-dimethylaniline?
The canonical SMILES for N,N-diethyl-2,6-dimethylaniline is CCN(CC)c1c(C)cccc1C.
What is the InChIKey of N,N-diethyl-2,6-dimethylaniline?
The InChIKey is KECFTDQVRIBMCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N/c1-5-13(6-2)12-10(3)8-7-9-11(12)4/h7-9H,5-6H2,1-4H3.
What are the key properties of N,N-diethyl-2,6-dimethylaniline?
N,N-diethyl-2,6-dimethylaniline has a molecular weight of 177.29 g/mol, XLogP of 3.15, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-2,6-dimethylaniline is sourced from PubChem (CID 520973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).