C23H28N2O7 — CID 5209904
3-O,5-O-diethyl 4-O-[2-(4-methylanilino)-2-oxoethyl] 2,6-dimethyl-1,4-dihydropyridine-3,4,5-tricarboxylate (PubChem CID 5209904) has the molecular formula C23H28N2O7 and a molecular weight of 444.48 g/mol. Its IUPAC name is 3-O,5-O-diethyl 4-O-[2-(4-methylanilino)-2-oxoethyl] 2,6-dimethyl-1,4-dihydropyridine-3,4,5-tricarboxylate.
| Compound Name | 3-O,5-O-diethyl 4-O-[2-(4-methylanilino)-2-oxoethyl] 2,6-dimethyl-1,4-dihydropyridine-3,4,5-tricarboxylate |
|---|---|
| PubChem CID | 5209904 |
| Molecular Formula | C23H28N2O7 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 3-O,5-O-diethyl 4-O-[2-(4-methylanilino)-2-oxoethyl] 2,6-dimethyl-1,4-dihydropyridine-3,4,5-tricarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1C(=O)OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C23H28N2O7/c1-6-30-21(27)18-14(4)24-15(5)19(22(28)31-7-2)20(18)23(29)32-12-17(26)25-16-10-8-13(3)9-11-16/h8-11,20,24H,6-7,12H2,1-5H3,(H,25,26) |
| InChIKey | JROUVKDMBPMGSF-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|