C23H23BrN2O2 — CID 5210106
2-[2-bromo-4-[(4-methylanilino)methyl]phenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 5210106) has the molecular formula C23H23BrN2O2 and a molecular weight of 439.35 g/mol. Its IUPAC name is 2-[2-bromo-4-[(4-methylanilino)methyl]phenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[2-bromo-4-[(4-methylanilino)methyl]phenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 5210106 |
| Molecular Formula | C23H23BrN2O2 |
| Molecular Weight | 439.35 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | 2-[2-bromo-4-[(4-methylanilino)methyl]phenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NCc2ccc(OCC(=O)Nc3ccc(C)cc3)c(Br)c2)cc1 |
| InChI | InChI=1S/C23H23BrN2O2/c1-16-3-8-19(9-4-16)25-14-18-7-12-22(21(24)13-18)28-15-23(27)26-20-10-5-17(2)6-11-20/h3-13,25H,14-15H2,1-2H3,(H,26,27) |
| InChIKey | DZKOVLFKTWYFMP-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.35 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |