C13H23N3O8S — CID 5211063
2-acetamido-3-methyl-3-nitrososulfanyl-N-[(2,3,4,5-tetrahydroxyoxan-2-yl)methyl]butanamide (PubChem CID 5211063) has the molecular formula C13H23N3O8S and a molecular weight of 381.41 g/mol. Its IUPAC name is 2-acetamido-3-methyl-3-nitrososulfanyl-N-[(2,3,4,5-tetrahydroxyoxan-2-yl)methyl]butanamide.
| Compound Name | 2-acetamido-3-methyl-3-nitrososulfanyl-N-[(2,3,4,5-tetrahydroxyoxan-2-yl)methyl]butanamide |
|---|---|
| PubChem CID | 5211063 |
| Molecular Formula | C13H23N3O8S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 2-acetamido-3-methyl-3-nitrososulfanyl-N-[(2,3,4,5-tetrahydroxyoxan-2-yl)methyl]butanamide |
| SMILES | CC(=O)NC(C(=O)NCC1(O)OCC(O)C(O)C1O)C(C)(C)SN=O |
| InChI | InChI=1S/C13H23N3O8S/c1-6(17)15-9(12(2,3)25-16-23)11(21)14-5-13(22)10(20)8(19)7(18)4-24-13/h7-10,18-20,22H,4-5H2,1-3H3,(H,14,21)(H,15,17) |
| InChIKey | PZUYSUGHXUBVOG-UHFFFAOYSA-N |
| XLogP | -2.40 |
| TPSA | 177.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|