About bis(trimethylsilyl) octanedioate
bis(trimethylsilyl) octanedioate (PubChem CID 521138) has the molecular formula C14H30O4Si2
and a molecular weight of 318.56 g/mol. Its IUPAC name is bis(trimethylsilyl) octanedioate.
Molecular Properties
| Compound Name | bis(trimethylsilyl) octanedioate |
| PubChem CID | 521138 |
| Molecular Formula | C14H30O4Si2 |
| Molecular Weight | 318.56 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | bis(trimethylsilyl) octanedioate |
| SMILES | C[Si](C)(C)OC(=O)CCCCCCC(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C14H30O4Si2/c1-19(2,3)17-13(15)11-9-7-8-10-12-14(16)18-20(4,5)6/h7-12H2,1-6H3 |
| InChIKey | LWDVKORSFQXPHL-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.56 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(trimethylsilyl) octanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(trimethylsilyl) octanedioate?
The IUPAC name of bis(trimethylsilyl) octanedioate (CID 521138) is bis(trimethylsilyl) octanedioate.
What is the SMILES notation for bis(trimethylsilyl) octanedioate?
The canonical SMILES for bis(trimethylsilyl) octanedioate is C[Si](C)(C)OC(=O)CCCCCCC(=O)O[Si](C)(C)C.
What is the InChIKey of bis(trimethylsilyl) octanedioate?
The InChIKey is LWDVKORSFQXPHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30O4Si2/c1-19(2,3)17-13(15)11-9-7-8-10-12-14(16)18-20(4,5)6/h7-12H2,1-6H3.
What are the key properties of bis(trimethylsilyl) octanedioate?
bis(trimethylsilyl) octanedioate has a molecular weight of 318.56 g/mol, XLogP of 4.08, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(trimethylsilyl) octanedioate is sourced from PubChem (CID 521138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).