C18H12N6O4S4 — CID 5211973
4-[[5-[[5-[(2,4-dihydroxyphenyl)methylideneamino]-1,3,4-thiadiazol-2-yl]disulfanyl]-1,3,4-thiadiazol-2-yl]iminomethyl]benzene-1,3-diol (PubChem CID 5211973) has the molecular formula C18H12N6O4S4 and a molecular weight of 504.60 g/mol. Its IUPAC name is 4-[[5-[[5-[(2,4-dihydroxyphenyl)methylideneamino]-1,3,4-thiadiazol-2-yl]disulfanyl]-1,3,4-thiadiazol-2-yl]iminomethyl]benzene-1,3-diol.
| Compound Name | 4-[[5-[[5-[(2,4-dihydroxyphenyl)methylideneamino]-1,3,4-thiadiazol-2-yl]disulfanyl]-1,3,4-thiadiazol-2-yl]iminomethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 5211973 |
| Molecular Formula | C18H12N6O4S4 |
| Molecular Weight | 504.60 g/mol |
| Exact Mass | 503.98 |
| IUPAC Name | 4-[[5-[[5-[(2,4-dihydroxyphenyl)methylideneamino]-1,3,4-thiadiazol-2-yl]disulfanyl]-1,3,4-thiadiazol-2-yl]iminomethyl]benzene-1,3-diol |
| SMILES | Oc1ccc(C=Nc2nnc(SSc3nnc(N=Cc4ccc(O)cc4O)s3)s2)c(O)c1 |
| InChI | InChI=1S/C18H12N6O4S4/c25-11-3-1-9(13(27)5-11)7-19-15-21-23-17(29-15)31-32-18-24-22-16(30-18)20-8-10-2-4-12(26)6-14(10)28/h1-8,25-28H |
| InChIKey | SUVOWFHIHWDSRY-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 157.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.60 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|