About pentan-2-ylcyclopentane
pentan-2-ylcyclopentane (PubChem CID 521217) has the molecular formula C10H20
and a molecular weight of 140.27 g/mol. Its IUPAC name is pentan-2-ylcyclopentane.
Molecular Properties
| Compound Name | pentan-2-ylcyclopentane |
| PubChem CID | 521217 |
| Molecular Formula | C10H20 |
| Molecular Weight | 140.27 g/mol |
| Exact Mass | 140.16 |
| IUPAC Name | pentan-2-ylcyclopentane |
| SMILES | CCCC(C)C1CCCC1 |
| InChI | InChI=1S/C10H20/c1-3-6-9(2)10-7-4-5-8-10/h9-10H,3-8H2,1-2H3 |
| InChIKey | ZXIYMCGSSPHRBV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.27 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze pentan-2-ylcyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-2-ylcyclopentane?
The IUPAC name of pentan-2-ylcyclopentane (CID 521217) is pentan-2-ylcyclopentane.
What is the SMILES notation for pentan-2-ylcyclopentane?
The canonical SMILES for pentan-2-ylcyclopentane is CCCC(C)C1CCCC1.
What is the InChIKey of pentan-2-ylcyclopentane?
The InChIKey is ZXIYMCGSSPHRBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20/c1-3-6-9(2)10-7-4-5-8-10/h9-10H,3-8H2,1-2H3.
What are the key properties of pentan-2-ylcyclopentane?
pentan-2-ylcyclopentane has a molecular weight of 140.27 g/mol, XLogP of 3.61, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-2-ylcyclopentane is sourced from PubChem (CID 521217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).