C10H6O4 — CID 521223
2,3-dihydronaphthalene-1,4,5,8-tetrone (PubChem CID 521223) has the molecular formula C10H6O4 and a molecular weight of 190.15 g/mol. Its IUPAC name is 2,3-dihydronaphthalene-1,4,5,8-tetrone.
| Compound Name | 2,3-dihydronaphthalene-1,4,5,8-tetrone |
|---|---|
| PubChem CID | 521223 |
| Molecular Formula | C10H6O4 |
| Molecular Weight | 190.15 g/mol |
| Exact Mass | 190.03 |
| IUPAC Name | 2,3-dihydronaphthalene-1,4,5,8-tetrone |
| SMILES | O=C1C=CC(=O)C2=C1C(=O)CCC2=O |
| InChI | InChI=1S/C10H6O4/c11-5-1-2-6(12)10-8(14)4-3-7(13)9(5)10/h1-2H,3-4H2 |
| InChIKey | WGJYITVFKWDWID-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.15 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|