About 2,5-dimethylundec-2-ene
2,5-dimethylundec-2-ene (PubChem CID 521257) has the molecular formula C13H26
and a molecular weight of 182.35 g/mol. Its IUPAC name is 2,5-dimethylundec-2-ene.
Molecular Properties
| Compound Name | 2,5-dimethylundec-2-ene |
| PubChem CID | 521257 |
| Molecular Formula | C13H26 |
| Molecular Weight | 182.35 g/mol |
| Exact Mass | 182.20 |
| IUPAC Name | 2,5-dimethylundec-2-ene |
| SMILES | CCCCCCC(C)CC=C(C)C |
| InChI | InChI=1S/C13H26/c1-5-6-7-8-9-13(4)11-10-12(2)3/h10,13H,5-9,11H2,1-4H3 |
| InChIKey | VIOGPKWXSDMDFJ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.35 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dimethylundec-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethylundec-2-ene?
The IUPAC name of 2,5-dimethylundec-2-ene (CID 521257) is 2,5-dimethylundec-2-ene.
What is the SMILES notation for 2,5-dimethylundec-2-ene?
The canonical SMILES for 2,5-dimethylundec-2-ene is CCCCCCC(C)CC=C(C)C.
What is the InChIKey of 2,5-dimethylundec-2-ene?
The InChIKey is VIOGPKWXSDMDFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26/c1-5-6-7-8-9-13(4)11-10-12(2)3/h10,13H,5-9,11H2,1-4H3.
What are the key properties of 2,5-dimethylundec-2-ene?
2,5-dimethylundec-2-ene has a molecular weight of 182.35 g/mol, XLogP of 4.95, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethylundec-2-ene is sourced from PubChem (CID 521257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).