About 2-ethylsulfanylbutane
2-ethylsulfanylbutane (PubChem CID 521270) has the molecular formula C6H14S
and a molecular weight of 118.25 g/mol. Its IUPAC name is 2-ethylsulfanylbutane.
Molecular Properties
| Compound Name | 2-ethylsulfanylbutane |
| PubChem CID | 521270 |
| Molecular Formula | C6H14S |
| Molecular Weight | 118.25 g/mol |
| Exact Mass | 118.08 |
| IUPAC Name | 2-ethylsulfanylbutane |
| SMILES | CCSC(C)CC |
| InChI | InChI=1S/C6H14S/c1-4-6(3)7-5-2/h6H,4-5H2,1-3H3 |
| InChIKey | JFNGZXUPUVUYST-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.25 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethylsulfanylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylsulfanylbutane?
The IUPAC name of 2-ethylsulfanylbutane (CID 521270) is 2-ethylsulfanylbutane.
What is the SMILES notation for 2-ethylsulfanylbutane?
The canonical SMILES for 2-ethylsulfanylbutane is CCSC(C)CC.
What is the InChIKey of 2-ethylsulfanylbutane?
The InChIKey is JFNGZXUPUVUYST-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14S/c1-4-6(3)7-5-2/h6H,4-5H2,1-3H3.
What are the key properties of 2-ethylsulfanylbutane?
2-ethylsulfanylbutane has a molecular weight of 118.25 g/mol, XLogP of 2.54, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylsulfanylbutane is sourced from PubChem (CID 521270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).