About 3-methylbutane-1,2-diol
3-methylbutane-1,2-diol (PubChem CID 521280) has the molecular formula C5H12O2
and a molecular weight of 104.15 g/mol. Its IUPAC name is 3-methylbutane-1,2-diol.
Molecular Properties
| Compound Name | 3-methylbutane-1,2-diol |
| PubChem CID | 521280 |
| Molecular Formula | C5H12O2 |
| Molecular Weight | 104.15 g/mol |
| Exact Mass | 104.08 |
| IUPAC Name | 3-methylbutane-1,2-diol |
| SMILES | CC(C)C(O)CO |
| InChI | InChI=1S/C5H12O2/c1-4(2)5(7)3-6/h4-7H,3H2,1-2H3 |
| InChIKey | HJJZIMFAIMUSBW-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.15 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methylbutane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutane-1,2-diol?
The IUPAC name of 3-methylbutane-1,2-diol (CID 521280) is 3-methylbutane-1,2-diol.
What is the SMILES notation for 3-methylbutane-1,2-diol?
The canonical SMILES for 3-methylbutane-1,2-diol is CC(C)C(O)CO.
What is the InChIKey of 3-methylbutane-1,2-diol?
The InChIKey is HJJZIMFAIMUSBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O2/c1-4(2)5(7)3-6/h4-7H,3H2,1-2H3.
What are the key properties of 3-methylbutane-1,2-diol?
3-methylbutane-1,2-diol has a molecular weight of 104.15 g/mol, XLogP of -0.00, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutane-1,2-diol is sourced from PubChem (CID 521280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).