C25H23ClN5O3S+ — CID 5212965
2-[[4-(4-chlorophenyl)-5-(4-methylphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]-N-[(4-hydroxy-3-methoxyphenyl)methylideneamino]acetamide (PubChem CID 5212965) has the molecular formula C25H23ClN5O3S+ and a molecular weight of 509.01 g/mol. Its IUPAC name is 2-[[4-(4-chlorophenyl)-5-(4-methylphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]-N-[(4-hydroxy-3-methoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[[4-(4-chlorophenyl)-5-(4-methylphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]-N-[(4-hydroxy-3-methoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 5212965 |
| Molecular Formula | C25H23ClN5O3S+ |
| Molecular Weight | 509.01 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | 2-[[4-(4-chlorophenyl)-5-(4-methylphenyl)-1H-1,2,4-triazol-4-ium-3-yl]sulfanyl]-N-[(4-hydroxy-3-methoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1cc(C=NNC(=O)CSc2n[nH]c(-c3ccc(C)cc3)[n+]2-c2ccc(Cl)cc2)ccc1O |
| InChI | InChI=1S/C25H22ClN5O3S/c1-16-3-6-18(7-4-16)24-29-30-25(31(24)20-10-8-19(26)9-11-20)35-15-23(33)28-27-14-17-5-12-21(32)22(13-17)34-2/h3-14H,15H2,1-2H3,(H2,27,28,32,33)/p+1 |
| InChIKey | HGFCEIDFLDVMKD-UHFFFAOYSA-O |
| XLogP | 4.27 |
| TPSA | 103.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.01 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|