About N-ethylpropanamide
N-ethylpropanamide (PubChem CID 521324) has the molecular formula C5H11NO
and a molecular weight of 101.15 g/mol. Its IUPAC name is N-ethylpropanamide.
Molecular Properties
| Compound Name | N-ethylpropanamide |
| PubChem CID | 521324 |
| Molecular Formula | C5H11NO |
| Molecular Weight | 101.15 g/mol |
| Exact Mass | 101.08 |
| IUPAC Name | N-ethylpropanamide |
| SMILES | CCNC(=O)CC |
| InChI | InChI=1S/C5H11NO/c1-3-5(7)6-4-2/h3-4H2,1-2H3,(H,6,7) |
| InChIKey | ABMDIECEEGFXNC-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.15 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-ethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylpropanamide?
The IUPAC name of N-ethylpropanamide (CID 521324) is N-ethylpropanamide.
What is the SMILES notation for N-ethylpropanamide?
The canonical SMILES for N-ethylpropanamide is CCNC(=O)CC.
What is the InChIKey of N-ethylpropanamide?
The InChIKey is ABMDIECEEGFXNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO/c1-3-5(7)6-4-2/h3-4H2,1-2H3,(H,6,7).
What are the key properties of N-ethylpropanamide?
N-ethylpropanamide has a molecular weight of 101.15 g/mol, XLogP of 0.53, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylpropanamide is sourced from PubChem (CID 521324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).