2,4,6-trichlorobenzenesulfonyl chloride

C6H2Cl4O2S — CID 521335

IUPAC2,4,6-trichlorobenzenesulfonyl chloride
SMILESO=S(=O)(Cl)c1c(Cl)cc(Cl)cc1Cl
InChIInChI=1S/C6H2Cl4O2S/c7-3-1-4(8)6(5(9)2-3)13(10,11)12/h1-2H
InChIKeyWHJAQKAAIOHCGN-UHFFFAOYSA-N
MW279.96 g/mol
LogP3.57
Rot. Bonds1

About 2,4,6-trichlorobenzenesulfonyl chloride

2,4,6-trichlorobenzenesulfonyl chloride (PubChem CID 521335) has the molecular formula C6H2Cl4O2S and a molecular weight of 279.96 g/mol. Its IUPAC name is 2,4,6-trichlorobenzenesulfonyl chloride.

Molecular Properties

Compound Name2,4,6-trichlorobenzenesulfonyl chloride
PubChem CID521335
Molecular FormulaC6H2Cl4O2S
Molecular Weight279.96 g/mol
Exact Mass277.85
IUPAC Name2,4,6-trichlorobenzenesulfonyl chloride
SMILESO=S(=O)(Cl)c1c(Cl)cc(Cl)cc1Cl
InChIInChI=1S/C6H2Cl4O2S/c7-3-1-4(8)6(5(9)2-3)13(10,11)12/h1-2H
InChIKeyWHJAQKAAIOHCGN-UHFFFAOYSA-N
XLogP3.57
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500279.96
LogP ≤ 53.57
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze 2,4,6-trichlorobenzenesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4,6-trichlorobenzenesulfonyl chloride?
The IUPAC name of 2,4,6-trichlorobenzenesulfonyl chloride (CID 521335) is 2,4,6-trichlorobenzenesulfonyl chloride.
What is the SMILES notation for 2,4,6-trichlorobenzenesulfonyl chloride?
The canonical SMILES for 2,4,6-trichlorobenzenesulfonyl chloride is O=S(=O)(Cl)c1c(Cl)cc(Cl)cc1Cl.
What is the InChIKey of 2,4,6-trichlorobenzenesulfonyl chloride?
The InChIKey is WHJAQKAAIOHCGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2Cl4O2S/c7-3-1-4(8)6(5(9)2-3)13(10,11)12/h1-2H.
What are the key properties of 2,4,6-trichlorobenzenesulfonyl chloride?
2,4,6-trichlorobenzenesulfonyl chloride has a molecular weight of 279.96 g/mol, XLogP of 3.57, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,6-trichlorobenzenesulfonyl chloride is sourced from PubChem (CID 521335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).