C35H54N2O4 — CID 5213968
cyclohexyl-[5,13-dihydroxy-5-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone (PubChem CID 5213968) has the molecular formula C35H54N2O4 and a molecular weight of 566.83 g/mol. Its IUPAC name is cyclohexyl-[5,13-dihydroxy-5-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone.
| Compound Name | cyclohexyl-[5,13-dihydroxy-5-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone |
|---|---|
| PubChem CID | 5213968 |
| Molecular Formula | C35H54N2O4 |
| Molecular Weight | 566.83 g/mol |
| Exact Mass | 566.41 |
| IUPAC Name | cyclohexyl-[5,13-dihydroxy-5-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)C4CCCCC4)=C3)C2CCC2(C)C1CCC2(O)CN1CCN(CCO)CC1 |
| InChI | InChI=1S/C35H54N2O4/c1-31-11-8-26(39)22-33(31)14-15-35(27(23-33)30(40)25-6-4-3-5-7-25)28(31)9-12-32(2)29(35)10-13-34(32,41)24-37-18-16-36(17-19-37)20-21-38/h14-15,23,25-26,28-29,38-39,41H,3-13,16-22,24H2,1-2H3 |
| InChIKey | ZWQJXKGFHNSKRZ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.83 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|