About N-[(3,4-dichlorophenyl)methyl]aniline
N-[(3,4-dichlorophenyl)methyl]aniline (PubChem CID 5214639) has the molecular formula C13H11Cl2N
and a molecular weight of 252.14 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]aniline.
Molecular Properties
| Compound Name | N-[(3,4-dichlorophenyl)methyl]aniline |
| PubChem CID | 5214639 |
| Molecular Formula | C13H11Cl2N |
| Molecular Weight | 252.14 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]aniline |
| SMILES | Clc1ccc(CNc2ccccc2)cc1Cl |
| InChI | InChI=1S/C13H11Cl2N/c14-12-7-6-10(8-13(12)15)9-16-11-4-2-1-3-5-11/h1-8,16H,9H2 |
| InChIKey | DNLJKKQHJDOTLP-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.14 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[(3,4-dichlorophenyl)methyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,4-dichlorophenyl)methyl]aniline?
The IUPAC name of N-[(3,4-dichlorophenyl)methyl]aniline (CID 5214639) is N-[(3,4-dichlorophenyl)methyl]aniline.
What is the SMILES notation for N-[(3,4-dichlorophenyl)methyl]aniline?
The canonical SMILES for N-[(3,4-dichlorophenyl)methyl]aniline is Clc1ccc(CNc2ccccc2)cc1Cl.
What is the InChIKey of N-[(3,4-dichlorophenyl)methyl]aniline?
The InChIKey is DNLJKKQHJDOTLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11Cl2N/c14-12-7-6-10(8-13(12)15)9-16-11-4-2-1-3-5-11/h1-8,16H,9H2.
What are the key properties of N-[(3,4-dichlorophenyl)methyl]aniline?
N-[(3,4-dichlorophenyl)methyl]aniline has a molecular weight of 252.14 g/mol, XLogP of 4.61, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,4-dichlorophenyl)methyl]aniline is sourced from PubChem (CID 5214639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).