About [2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] 2-[(3,5-dimethoxybenzoyl)amino]acetate
[2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] 2-[(3,5-dimethoxybenzoyl)amino]acetate (PubChem CID 5214804) has the molecular formula C23H28N2O6
and a molecular weight of 428.49 g/mol. Its IUPAC name is [2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] 2-[(3,5-dimethoxybenzoyl)amino]acetate.
Molecular Properties
| Compound Name | [2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] 2-[(3,5-dimethoxybenzoyl)amino]acetate |
| PubChem CID | 5214804 |
| Molecular Formula | C23H28N2O6 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | [2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] 2-[(3,5-dimethoxybenzoyl)amino]acetate |
| SMILES | COc1cc(OC)cc(C(=O)NCC(=O)OCC(=O)NC(C)CCc2ccccc2)c1 |
| InChI | InChI=1S/C23H28N2O6/c1-16(9-10-17-7-5-4-6-8-17)25-21(26)15-31-22(27)14-24-23(28)18-11-19(29-2)13-20(12-18)30-3/h4-8,11-13,16H,9-10,14-15H2,1-3H3,(H,24,28)(H,25,26) |
| InChIKey | YHDIKSNHVPGLRR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] 2-[(3,5-dimethoxybenzoyl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] 2-[(3,5-dimethoxybenzoyl)amino]acetate?
The IUPAC name of [2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] 2-[(3,5-dimethoxybenzoyl)amino]acetate (CID 5214804) is [2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] 2-[(3,5-dimethoxybenzoyl)amino]acetate.
What is the SMILES notation for [2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] 2-[(3,5-dimethoxybenzoyl)amino]acetate?
The canonical SMILES for [2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] 2-[(3,5-dimethoxybenzoyl)amino]acetate is COc1cc(OC)cc(C(=O)NCC(=O)OCC(=O)NC(C)CCc2ccccc2)c1.
What is the InChIKey of [2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] 2-[(3,5-dimethoxybenzoyl)amino]acetate?
The InChIKey is YHDIKSNHVPGLRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28N2O6/c1-16(9-10-17-7-5-4-6-8-17)25-21(26)15-31-22(27)14-24-23(28)18-11-19(29-2)13-20(12-18)30-3/h4-8,11-13,16H,9-10,14-15H2,1-3H3,(H,24,28)(H,25,26).
What are the key properties of [2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] 2-[(3,5-dimethoxybenzoyl)amino]acetate?
[2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] 2-[(3,5-dimethoxybenzoyl)amino]acetate has a molecular weight of 428.49 g/mol, XLogP of 2.11, 11 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] 2-[(3,5-dimethoxybenzoyl)amino]acetate is sourced from PubChem (CID 5214804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).