About N-ethylpentanamide
N-ethylpentanamide (PubChem CID 521484) has the molecular formula C7H15NO
and a molecular weight of 129.20 g/mol. Its IUPAC name is N-ethylpentanamide.
Molecular Properties
| Compound Name | N-ethylpentanamide |
| PubChem CID | 521484 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | N-ethylpentanamide |
| SMILES | CCCCC(=O)NCC |
| InChI | InChI=1S/C7H15NO/c1-3-5-6-7(9)8-4-2/h3-6H2,1-2H3,(H,8,9) |
| InChIKey | ZOQTYYYRQHZQAR-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-ethylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylpentanamide?
The IUPAC name of N-ethylpentanamide (CID 521484) is N-ethylpentanamide.
What is the SMILES notation for N-ethylpentanamide?
The canonical SMILES for N-ethylpentanamide is CCCCC(=O)NCC.
What is the InChIKey of N-ethylpentanamide?
The InChIKey is ZOQTYYYRQHZQAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO/c1-3-5-6-7(9)8-4-2/h3-6H2,1-2H3,(H,8,9).
What are the key properties of N-ethylpentanamide?
N-ethylpentanamide has a molecular weight of 129.20 g/mol, XLogP of 1.31, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylpentanamide is sourced from PubChem (CID 521484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).