About 1-(carbamothioylamino)-3-(3,4-dichlorophenyl)urea
1-(carbamothioylamino)-3-(3,4-dichlorophenyl)urea (PubChem CID 5215431) has the molecular formula C8H8Cl2N4OS
and a molecular weight of 279.15 g/mol. Its IUPAC name is 1-(carbamothioylamino)-3-(3,4-dichlorophenyl)urea.
Molecular Properties
| Compound Name | 1-(carbamothioylamino)-3-(3,4-dichlorophenyl)urea |
| PubChem CID | 5215431 |
| Molecular Formula | C8H8Cl2N4OS |
| Molecular Weight | 279.15 g/mol |
| Exact Mass | 277.98 |
| IUPAC Name | 1-(carbamothioylamino)-3-(3,4-dichlorophenyl)urea |
| SMILES | NC(=S)NNC(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C8H8Cl2N4OS/c9-5-2-1-4(3-6(5)10)12-8(15)14-13-7(11)16/h1-3H,(H3,11,13,16)(H2,12,14,15) |
| InChIKey | YQLNXLZJSXZCFX-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.15 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(carbamothioylamino)-3-(3,4-dichlorophenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(carbamothioylamino)-3-(3,4-dichlorophenyl)urea?
The IUPAC name of 1-(carbamothioylamino)-3-(3,4-dichlorophenyl)urea (CID 5215431) is 1-(carbamothioylamino)-3-(3,4-dichlorophenyl)urea.
What is the SMILES notation for 1-(carbamothioylamino)-3-(3,4-dichlorophenyl)urea?
The canonical SMILES for 1-(carbamothioylamino)-3-(3,4-dichlorophenyl)urea is NC(=S)NNC(=O)Nc1ccc(Cl)c(Cl)c1.
What is the InChIKey of 1-(carbamothioylamino)-3-(3,4-dichlorophenyl)urea?
The InChIKey is YQLNXLZJSXZCFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8Cl2N4OS/c9-5-2-1-4(3-6(5)10)12-8(15)14-13-7(11)16/h1-3H,(H3,11,13,16)(H2,12,14,15).
What are the key properties of 1-(carbamothioylamino)-3-(3,4-dichlorophenyl)urea?
1-(carbamothioylamino)-3-(3,4-dichlorophenyl)urea has a molecular weight of 279.15 g/mol, XLogP of 1.86, 1 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(carbamothioylamino)-3-(3,4-dichlorophenyl)urea is sourced from PubChem (CID 5215431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).