About dimethyl 2,5-diethylhexanedioate
dimethyl 2,5-diethylhexanedioate (PubChem CID 521588) has the molecular formula C12H22O4
and a molecular weight of 230.30 g/mol. Its IUPAC name is dimethyl 2,5-diethylhexanedioate.
Molecular Properties
| Compound Name | dimethyl 2,5-diethylhexanedioate |
| PubChem CID | 521588 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | dimethyl 2,5-diethylhexanedioate |
| SMILES | CCC(CCC(CC)C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C12H22O4/c1-5-9(11(13)15-3)7-8-10(6-2)12(14)16-4/h9-10H,5-8H2,1-4H3 |
| InChIKey | MHQZDNUNANBSDM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze dimethyl 2,5-diethylhexanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2,5-diethylhexanedioate?
The IUPAC name of dimethyl 2,5-diethylhexanedioate (CID 521588) is dimethyl 2,5-diethylhexanedioate.
What is the SMILES notation for dimethyl 2,5-diethylhexanedioate?
The canonical SMILES for dimethyl 2,5-diethylhexanedioate is CCC(CCC(CC)C(=O)OC)C(=O)OC.
What is the InChIKey of dimethyl 2,5-diethylhexanedioate?
The InChIKey is MHQZDNUNANBSDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O4/c1-5-9(11(13)15-3)7-8-10(6-2)12(14)16-4/h9-10H,5-8H2,1-4H3.
What are the key properties of dimethyl 2,5-diethylhexanedioate?
dimethyl 2,5-diethylhexanedioate has a molecular weight of 230.30 g/mol, XLogP of 2.16, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2,5-diethylhexanedioate is sourced from PubChem (CID 521588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).