About trimethylsilyl decanoate
trimethylsilyl decanoate (PubChem CID 521628) has the molecular formula C13H28O2Si
and a molecular weight of 244.45 g/mol. Its IUPAC name is trimethylsilyl decanoate.
Molecular Properties
| Compound Name | trimethylsilyl decanoate |
| PubChem CID | 521628 |
| Molecular Formula | C13H28O2Si |
| Molecular Weight | 244.45 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | trimethylsilyl decanoate |
| SMILES | CCCCCCCCCC(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C13H28O2Si/c1-5-6-7-8-9-10-11-12-13(14)15-16(2,3)4/h5-12H2,1-4H3 |
| InChIKey | FGTNBYWFNITQJR-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.45 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethylsilyl decanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethylsilyl decanoate?
The IUPAC name of trimethylsilyl decanoate (CID 521628) is trimethylsilyl decanoate.
What is the SMILES notation for trimethylsilyl decanoate?
The canonical SMILES for trimethylsilyl decanoate is CCCCCCCCCC(=O)O[Si](C)(C)C.
What is the InChIKey of trimethylsilyl decanoate?
The InChIKey is FGTNBYWFNITQJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28O2Si/c1-5-6-7-8-9-10-11-12-13(14)15-16(2,3)4/h5-12H2,1-4H3.
What are the key properties of trimethylsilyl decanoate?
trimethylsilyl decanoate has a molecular weight of 244.45 g/mol, XLogP of 4.51, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trimethylsilyl decanoate is sourced from PubChem (CID 521628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).