About bis(trimethylsilyl) 3-methylhexanedioate
bis(trimethylsilyl) 3-methylhexanedioate (PubChem CID 521639) has the molecular formula C13H28O4Si2
and a molecular weight of 304.54 g/mol. Its IUPAC name is bis(trimethylsilyl) 3-methylhexanedioate.
Molecular Properties
| Compound Name | bis(trimethylsilyl) 3-methylhexanedioate |
| PubChem CID | 521639 |
| Molecular Formula | C13H28O4Si2 |
| Molecular Weight | 304.54 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | bis(trimethylsilyl) 3-methylhexanedioate |
| SMILES | CC(CCC(=O)O[Si](C)(C)C)CC(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C13H28O4Si2/c1-11(10-13(15)17-19(5,6)7)8-9-12(14)16-18(2,3)4/h11H,8-10H2,1-7H3 |
| InChIKey | IDHDZCKJOKHATB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.54 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(trimethylsilyl) 3-methylhexanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(trimethylsilyl) 3-methylhexanedioate?
The IUPAC name of bis(trimethylsilyl) 3-methylhexanedioate (CID 521639) is bis(trimethylsilyl) 3-methylhexanedioate.
What is the SMILES notation for bis(trimethylsilyl) 3-methylhexanedioate?
The canonical SMILES for bis(trimethylsilyl) 3-methylhexanedioate is CC(CCC(=O)O[Si](C)(C)C)CC(=O)O[Si](C)(C)C.
What is the InChIKey of bis(trimethylsilyl) 3-methylhexanedioate?
The InChIKey is IDHDZCKJOKHATB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28O4Si2/c1-11(10-13(15)17-19(5,6)7)8-9-12(14)16-18(2,3)4/h11H,8-10H2,1-7H3.
What are the key properties of bis(trimethylsilyl) 3-methylhexanedioate?
bis(trimethylsilyl) 3-methylhexanedioate has a molecular weight of 304.54 g/mol, XLogP of 3.55, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(trimethylsilyl) 3-methylhexanedioate is sourced from PubChem (CID 521639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).