About [1-tert-butyl-3-methyl-4-(4-methylphenyl)sulfonylpyrazol-5-yl] 3,5-dimethoxybenzoate
[1-tert-butyl-3-methyl-4-(4-methylphenyl)sulfonylpyrazol-5-yl] 3,5-dimethoxybenzoate (PubChem CID 5216653) has the molecular formula C24H28N2O6S
and a molecular weight of 472.56 g/mol. Its IUPAC name is [1-tert-butyl-3-methyl-4-(4-methylphenyl)sulfonylpyrazol-5-yl] 3,5-dimethoxybenzoate.
Molecular Properties
| Compound Name | [1-tert-butyl-3-methyl-4-(4-methylphenyl)sulfonylpyrazol-5-yl] 3,5-dimethoxybenzoate |
| PubChem CID | 5216653 |
| Molecular Formula | C24H28N2O6S |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | [1-tert-butyl-3-methyl-4-(4-methylphenyl)sulfonylpyrazol-5-yl] 3,5-dimethoxybenzoate |
| SMILES | COc1cc(OC)cc(C(=O)Oc2c(S(=O)(=O)c3ccc(C)cc3)c(C)nn2C(C)(C)C)c1 |
| InChI | InChI=1S/C24H28N2O6S/c1-15-8-10-20(11-9-15)33(28,29)21-16(2)25-26(24(3,4)5)22(21)32-23(27)17-12-18(30-6)14-19(13-17)31-7/h8-14H,1-7H3 |
| InChIKey | PKNIOWBKKFLPNS-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 96.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [1-tert-butyl-3-methyl-4-(4-methylphenyl)sulfonylpyrazol-5-yl] 3,5-dimethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-tert-butyl-3-methyl-4-(4-methylphenyl)sulfonylpyrazol-5-yl] 3,5-dimethoxybenzoate?
The IUPAC name of [1-tert-butyl-3-methyl-4-(4-methylphenyl)sulfonylpyrazol-5-yl] 3,5-dimethoxybenzoate (CID 5216653) is [1-tert-butyl-3-methyl-4-(4-methylphenyl)sulfonylpyrazol-5-yl] 3,5-dimethoxybenzoate.
What is the SMILES notation for [1-tert-butyl-3-methyl-4-(4-methylphenyl)sulfonylpyrazol-5-yl] 3,5-dimethoxybenzoate?
The canonical SMILES for [1-tert-butyl-3-methyl-4-(4-methylphenyl)sulfonylpyrazol-5-yl] 3,5-dimethoxybenzoate is COc1cc(OC)cc(C(=O)Oc2c(S(=O)(=O)c3ccc(C)cc3)c(C)nn2C(C)(C)C)c1.
What is the InChIKey of [1-tert-butyl-3-methyl-4-(4-methylphenyl)sulfonylpyrazol-5-yl] 3,5-dimethoxybenzoate?
The InChIKey is PKNIOWBKKFLPNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28N2O6S/c1-15-8-10-20(11-9-15)33(28,29)21-16(2)25-26(24(3,4)5)22(21)32-23(27)17-12-18(30-6)14-19(13-17)31-7/h8-14H,1-7H3.
What are the key properties of [1-tert-butyl-3-methyl-4-(4-methylphenyl)sulfonylpyrazol-5-yl] 3,5-dimethoxybenzoate?
[1-tert-butyl-3-methyl-4-(4-methylphenyl)sulfonylpyrazol-5-yl] 3,5-dimethoxybenzoate has a molecular weight of 472.56 g/mol, XLogP of 4.32, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [1-tert-butyl-3-methyl-4-(4-methylphenyl)sulfonylpyrazol-5-yl] 3,5-dimethoxybenzoate is sourced from PubChem (CID 5216653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).