C9H17NO3Si — CID 521688
trimethylsilyl 2-(2-methylprop-2-enoylamino)acetate (PubChem CID 521688) has the molecular formula C9H17NO3Si and a molecular weight of 215.32 g/mol. Its IUPAC name is trimethylsilyl 2-(2-methylprop-2-enoylamino)acetate.
| Compound Name | trimethylsilyl 2-(2-methylprop-2-enoylamino)acetate |
|---|---|
| PubChem CID | 521688 |
| Molecular Formula | C9H17NO3Si |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | trimethylsilyl 2-(2-methylprop-2-enoylamino)acetate |
| SMILES | C=C(C)C(=O)NCC(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C9H17NO3Si/c1-7(2)9(12)10-6-8(11)13-14(3,4)5/h1,6H2,2-5H3,(H,10,12) |
| InChIKey | RDRGQWUCWBAIAJ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|