C24H21F4N3O5S — CID 5216904
2,3,4,5-tetrafluoro-N-[3-[(2-methoxyphenyl)sulfamoyl]-4-morpholin-4-ylphenyl]benzamide (PubChem CID 5216904) has the molecular formula C24H21F4N3O5S and a molecular weight of 539.51 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-N-[3-[(2-methoxyphenyl)sulfamoyl]-4-morpholin-4-ylphenyl]benzamide.
| Compound Name | 2,3,4,5-tetrafluoro-N-[3-[(2-methoxyphenyl)sulfamoyl]-4-morpholin-4-ylphenyl]benzamide |
|---|---|
| PubChem CID | 5216904 |
| Molecular Formula | C24H21F4N3O5S |
| Molecular Weight | 539.51 g/mol |
| Exact Mass | 539.11 |
| IUPAC Name | 2,3,4,5-tetrafluoro-N-[3-[(2-methoxyphenyl)sulfamoyl]-4-morpholin-4-ylphenyl]benzamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1cc(NC(=O)c2cc(F)c(F)c(F)c2F)ccc1N1CCOCC1 |
| InChI | InChI=1S/C24H21F4N3O5S/c1-35-19-5-3-2-4-17(19)30-37(33,34)20-12-14(6-7-18(20)31-8-10-36-11-9-31)29-24(32)15-13-16(25)22(27)23(28)21(15)26/h2-7,12-13,30H,8-11H2,1H3,(H,29,32) |
| InChIKey | KQZOJGVATWUJAM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.51 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|