About tris(trimethylsilyl) prop-1-ene-1,2,3-tricarboxylate
tris(trimethylsilyl) prop-1-ene-1,2,3-tricarboxylate (PubChem CID 521697) has the molecular formula C15H30O6Si3
and a molecular weight of 390.66 g/mol. Its IUPAC name is tris(trimethylsilyl) prop-1-ene-1,2,3-tricarboxylate.
Molecular Properties
| Compound Name | tris(trimethylsilyl) prop-1-ene-1,2,3-tricarboxylate |
| PubChem CID | 521697 |
| Molecular Formula | C15H30O6Si3 |
| Molecular Weight | 390.66 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | tris(trimethylsilyl) prop-1-ene-1,2,3-tricarboxylate |
| SMILES | C[Si](C)(C)OC(=O)C=C(CC(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C15H30O6Si3/c1-22(2,3)19-13(16)10-12(15(18)21-24(7,8)9)11-14(17)20-23(4,5)6/h10H,11H2,1-9H3 |
| InChIKey | RHDPKJMZPKZKTA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.66 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tris(trimethylsilyl) prop-1-ene-1,2,3-tricarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(trimethylsilyl) prop-1-ene-1,2,3-tricarboxylate?
The IUPAC name of tris(trimethylsilyl) prop-1-ene-1,2,3-tricarboxylate (CID 521697) is tris(trimethylsilyl) prop-1-ene-1,2,3-tricarboxylate.
What is the SMILES notation for tris(trimethylsilyl) prop-1-ene-1,2,3-tricarboxylate?
The canonical SMILES for tris(trimethylsilyl) prop-1-ene-1,2,3-tricarboxylate is C[Si](C)(C)OC(=O)C=C(CC(=O)O[Si](C)(C)C)C(=O)O[Si](C)(C)C.
What is the InChIKey of tris(trimethylsilyl) prop-1-ene-1,2,3-tricarboxylate?
The InChIKey is RHDPKJMZPKZKTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O6Si3/c1-22(2,3)19-13(16)10-12(15(18)21-24(7,8)9)11-14(17)20-23(4,5)6/h10H,11H2,1-9H3.
What are the key properties of tris(trimethylsilyl) prop-1-ene-1,2,3-tricarboxylate?
tris(trimethylsilyl) prop-1-ene-1,2,3-tricarboxylate has a molecular weight of 390.66 g/mol, XLogP of 3.44, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tris(trimethylsilyl) prop-1-ene-1,2,3-tricarboxylate is sourced from PubChem (CID 521697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).