C15H21NO2 — CID 5217129
N,N-bis[(5-methylfuran-2-yl)methyl]propan-1-amine (PubChem CID 5217129) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is N,N-bis[(5-methylfuran-2-yl)methyl]propan-1-amine.
| Compound Name | N,N-bis[(5-methylfuran-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 5217129 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | N,N-bis[(5-methylfuran-2-yl)methyl]propan-1-amine |
| SMILES | CCCN(Cc1ccc(C)o1)Cc1ccc(C)o1 |
| InChI | InChI=1S/C15H21NO2/c1-4-9-16(10-14-7-5-12(2)17-14)11-15-8-6-13(3)18-15/h5-8H,4,9-11H2,1-3H3 |
| InChIKey | QOQUJAVJUYJFCZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 29.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |