About 3-bromo-2-ethoxy-3,4-dihydro-2H-pyran-6-carboxamide
3-bromo-2-ethoxy-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 5217229) has the molecular formula C8H12BrNO3
and a molecular weight of 250.09 g/mol. Its IUPAC name is 3-bromo-2-ethoxy-3,4-dihydro-2H-pyran-6-carboxamide.
Molecular Properties
| Compound Name | 3-bromo-2-ethoxy-3,4-dihydro-2H-pyran-6-carboxamide |
| PubChem CID | 5217229 |
| Molecular Formula | C8H12BrNO3 |
| Molecular Weight | 250.09 g/mol |
| Exact Mass | 249.00 |
| IUPAC Name | 3-bromo-2-ethoxy-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | CCOC1OC(C(N)=O)=CCC1Br |
| InChI | InChI=1S/C8H12BrNO3/c1-2-12-8-5(9)3-4-6(13-8)7(10)11/h4-5,8H,2-3H2,1H3,(H2,10,11) |
| InChIKey | ZHBWFGRERMQGJI-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.09 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-2-ethoxy-3,4-dihydro-2H-pyran-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2-ethoxy-3,4-dihydro-2H-pyran-6-carboxamide?
The IUPAC name of 3-bromo-2-ethoxy-3,4-dihydro-2H-pyran-6-carboxamide (CID 5217229) is 3-bromo-2-ethoxy-3,4-dihydro-2H-pyran-6-carboxamide.
What is the SMILES notation for 3-bromo-2-ethoxy-3,4-dihydro-2H-pyran-6-carboxamide?
The canonical SMILES for 3-bromo-2-ethoxy-3,4-dihydro-2H-pyran-6-carboxamide is CCOC1OC(C(N)=O)=CCC1Br.
What is the InChIKey of 3-bromo-2-ethoxy-3,4-dihydro-2H-pyran-6-carboxamide?
The InChIKey is ZHBWFGRERMQGJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12BrNO3/c1-2-12-8-5(9)3-4-6(13-8)7(10)11/h4-5,8H,2-3H2,1H3,(H2,10,11).
What are the key properties of 3-bromo-2-ethoxy-3,4-dihydro-2H-pyran-6-carboxamide?
3-bromo-2-ethoxy-3,4-dihydro-2H-pyran-6-carboxamide has a molecular weight of 250.09 g/mol, XLogP of 0.90, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2-ethoxy-3,4-dihydro-2H-pyran-6-carboxamide is sourced from PubChem (CID 5217229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).