C10H6Cl6 — CID 521750
2,3,4,5,6,10-hexachlorotricyclo[5.2.1.04,8]deca-2,5-diene (PubChem CID 521750) has the molecular formula C10H6Cl6 and a molecular weight of 338.88 g/mol. Its IUPAC name is 2,3,4,5,6,10-hexachlorotricyclo[5.2.1.04,8]deca-2,5-diene.
| Compound Name | 2,3,4,5,6,10-hexachlorotricyclo[5.2.1.04,8]deca-2,5-diene |
|---|---|
| PubChem CID | 521750 |
| Molecular Formula | C10H6Cl6 |
| Molecular Weight | 338.88 g/mol |
| Exact Mass | 335.86 |
| IUPAC Name | 2,3,4,5,6,10-hexachlorotricyclo[5.2.1.04,8]deca-2,5-diene |
| SMILES | ClC1=C(Cl)C2(Cl)C(Cl)=C(Cl)C3C(Cl)C1CC32 |
| InChI | InChI=1S/C10H6Cl6/c11-5-2-1-3-4(5)7(13)9(15)10(3,16)8(14)6(2)12/h2-5H,1H2 |
| InChIKey | SVGYVZYRIHEIML-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.88 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|