About 5-(2-methylpropyl)-2,3-dihydrofuran
5-(2-methylpropyl)-2,3-dihydrofuran (PubChem CID 521760) has the molecular formula C8H14O
and a molecular weight of 126.20 g/mol. Its IUPAC name is 5-(2-methylpropyl)-2,3-dihydrofuran.
Molecular Properties
| Compound Name | 5-(2-methylpropyl)-2,3-dihydrofuran |
| PubChem CID | 521760 |
| Molecular Formula | C8H14O |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | 5-(2-methylpropyl)-2,3-dihydrofuran |
| SMILES | CC(C)CC1=CCCO1 |
| InChI | InChI=1S/C8H14O/c1-7(2)6-8-4-3-5-9-8/h4,7H,3,5-6H2,1-2H3 |
| InChIKey | FBQBYCIPUSEWMX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(2-methylpropyl)-2,3-dihydrofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-methylpropyl)-2,3-dihydrofuran?
The IUPAC name of 5-(2-methylpropyl)-2,3-dihydrofuran (CID 521760) is 5-(2-methylpropyl)-2,3-dihydrofuran.
What is the SMILES notation for 5-(2-methylpropyl)-2,3-dihydrofuran?
The canonical SMILES for 5-(2-methylpropyl)-2,3-dihydrofuran is CC(C)CC1=CCCO1.
What is the InChIKey of 5-(2-methylpropyl)-2,3-dihydrofuran?
The InChIKey is FBQBYCIPUSEWMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O/c1-7(2)6-8-4-3-5-9-8/h4,7H,3,5-6H2,1-2H3.
What are the key properties of 5-(2-methylpropyl)-2,3-dihydrofuran?
5-(2-methylpropyl)-2,3-dihydrofuran has a molecular weight of 126.20 g/mol, XLogP of 2.34, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-methylpropyl)-2,3-dihydrofuran is sourced from PubChem (CID 521760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).