About N-benzyl-2-nitroaniline
N-benzyl-2-nitroaniline (PubChem CID 521800) has the molecular formula C13H12N2O2
and a molecular weight of 228.25 g/mol. Its IUPAC name is N-benzyl-2-nitroaniline.
Molecular Properties
| Compound Name | N-benzyl-2-nitroaniline |
| PubChem CID | 521800 |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | N-benzyl-2-nitroaniline |
| SMILES | O=[N+]([O-])c1ccccc1NCc1ccccc1 |
| InChI | InChI=1S/C13H12N2O2/c16-15(17)13-9-5-4-8-12(13)14-10-11-6-2-1-3-7-11/h1-9,14H,10H2 |
| InChIKey | LAOUKNRSKBRAMQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-2-nitroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2-nitroaniline?
The IUPAC name of N-benzyl-2-nitroaniline (CID 521800) is N-benzyl-2-nitroaniline.
What is the SMILES notation for N-benzyl-2-nitroaniline?
The canonical SMILES for N-benzyl-2-nitroaniline is O=[N+]([O-])c1ccccc1NCc1ccccc1.
What is the InChIKey of N-benzyl-2-nitroaniline?
The InChIKey is LAOUKNRSKBRAMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O2/c16-15(17)13-9-5-4-8-12(13)14-10-11-6-2-1-3-7-11/h1-9,14H,10H2.
What are the key properties of N-benzyl-2-nitroaniline?
N-benzyl-2-nitroaniline has a molecular weight of 228.25 g/mol, XLogP of 3.21, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2-nitroaniline is sourced from PubChem (CID 521800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).