About 4-(4-ethylphenyl)benzoic acid
4-(4-ethylphenyl)benzoic acid (PubChem CID 521801) has the molecular formula C15H14O2
and a molecular weight of 226.27 g/mol. Its IUPAC name is 4-(4-ethylphenyl)benzoic acid.
Molecular Properties
| Compound Name | 4-(4-ethylphenyl)benzoic acid |
| PubChem CID | 521801 |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 4-(4-ethylphenyl)benzoic acid |
| SMILES | CCc1ccc(-c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C15H14O2/c1-2-11-3-5-12(6-4-11)13-7-9-14(10-8-13)15(16)17/h3-10H,2H2,1H3,(H,16,17) |
| InChIKey | SCEBDBNGUCNRCE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(4-ethylphenyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-ethylphenyl)benzoic acid?
The IUPAC name of 4-(4-ethylphenyl)benzoic acid (CID 521801) is 4-(4-ethylphenyl)benzoic acid.
What is the SMILES notation for 4-(4-ethylphenyl)benzoic acid?
The canonical SMILES for 4-(4-ethylphenyl)benzoic acid is CCc1ccc(-c2ccc(C(=O)O)cc2)cc1.
What is the InChIKey of 4-(4-ethylphenyl)benzoic acid?
The InChIKey is SCEBDBNGUCNRCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O2/c1-2-11-3-5-12(6-4-11)13-7-9-14(10-8-13)15(16)17/h3-10H,2H2,1H3,(H,16,17).
What are the key properties of 4-(4-ethylphenyl)benzoic acid?
4-(4-ethylphenyl)benzoic acid has a molecular weight of 226.27 g/mol, XLogP of 3.61, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-ethylphenyl)benzoic acid is sourced from PubChem (CID 521801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).