C24H12Br4O7 — CID 5218602
(6'-acetyloxy-2',4',5',7'-tetrabromo-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate (PubChem CID 5218602) has the molecular formula C24H12Br4O7 and a molecular weight of 731.97 g/mol. Its IUPAC name is (6'-acetyloxy-2',4',5',7'-tetrabromo-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate.
| Compound Name | (6'-acetyloxy-2',4',5',7'-tetrabromo-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate |
|---|---|
| PubChem CID | 5218602 |
| Molecular Formula | C24H12Br4O7 |
| Molecular Weight | 731.97 g/mol |
| Exact Mass | 727.73 |
| IUPAC Name | (6'-acetyloxy-2',4',5',7'-tetrabromo-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate |
| SMILES | CC(=O)Oc1c(Br)cc2c(c1Br)Oc1c(cc(Br)c(OC(C)=O)c1Br)C21OC(=O)c2ccccc21 |
| InChI | InChI=1S/C24H12Br4O7/c1-9(29)32-21-15(25)7-13-19(17(21)27)34-20-14(8-16(26)22(18(20)28)33-10(2)30)24(13)12-6-4-3-5-11(12)23(31)35-24/h3-8H,1-2H3 |
| InChIKey | ADWIDTFZSUABGT-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.97 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|