About 1,1,3-tribromopropan-2-ol
1,1,3-tribromopropan-2-ol (PubChem CID 521868) has the molecular formula C3H5Br3O
and a molecular weight of 296.78 g/mol. Its IUPAC name is 1,1,3-tribromopropan-2-ol.
Molecular Properties
| Compound Name | 1,1,3-tribromopropan-2-ol |
| PubChem CID | 521868 |
| Molecular Formula | C3H5Br3O |
| Molecular Weight | 296.78 g/mol |
| Exact Mass | 293.79 |
| IUPAC Name | 1,1,3-tribromopropan-2-ol |
| SMILES | OC(CBr)C(Br)Br |
| InChI | InChI=1S/C3H5Br3O/c4-1-2(7)3(5)6/h2-3,7H,1H2 |
| InChIKey | QDJVPMNYRGTTFU-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.78 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,1,3-tribromopropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,3-tribromopropan-2-ol?
The IUPAC name of 1,1,3-tribromopropan-2-ol (CID 521868) is 1,1,3-tribromopropan-2-ol.
What is the SMILES notation for 1,1,3-tribromopropan-2-ol?
The canonical SMILES for 1,1,3-tribromopropan-2-ol is OC(CBr)C(Br)Br.
What is the InChIKey of 1,1,3-tribromopropan-2-ol?
The InChIKey is QDJVPMNYRGTTFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5Br3O/c4-1-2(7)3(5)6/h2-3,7H,1H2.
What are the key properties of 1,1,3-tribromopropan-2-ol?
1,1,3-tribromopropan-2-ol has a molecular weight of 296.78 g/mol, XLogP of 1.86, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,3-tribromopropan-2-ol is sourced from PubChem (CID 521868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).