About 1-chloro-2,3-dimethylbutane
1-chloro-2,3-dimethylbutane (PubChem CID 521910) has the molecular formula C6H13Cl
and a molecular weight of 120.62 g/mol. Its IUPAC name is 1-chloro-2,3-dimethylbutane.
Molecular Properties
| Compound Name | 1-chloro-2,3-dimethylbutane |
| PubChem CID | 521910 |
| Molecular Formula | C6H13Cl |
| Molecular Weight | 120.62 g/mol |
| Exact Mass | 120.07 |
| IUPAC Name | 1-chloro-2,3-dimethylbutane |
| SMILES | CC(C)C(C)CCl |
| InChI | InChI=1S/C6H13Cl/c1-5(2)6(3)4-7/h5-6H,4H2,1-3H3 |
| InChIKey | UMJSXTUELCDYKZ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.62 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-2,3-dimethylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2,3-dimethylbutane?
The IUPAC name of 1-chloro-2,3-dimethylbutane (CID 521910) is 1-chloro-2,3-dimethylbutane.
What is the SMILES notation for 1-chloro-2,3-dimethylbutane?
The canonical SMILES for 1-chloro-2,3-dimethylbutane is CC(C)C(C)CCl.
What is the InChIKey of 1-chloro-2,3-dimethylbutane?
The InChIKey is UMJSXTUELCDYKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13Cl/c1-5(2)6(3)4-7/h5-6H,4H2,1-3H3.
What are the key properties of 1-chloro-2,3-dimethylbutane?
1-chloro-2,3-dimethylbutane has a molecular weight of 120.62 g/mol, XLogP of 2.52, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2,3-dimethylbutane is sourced from PubChem (CID 521910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).