C18H22O6 — CID 5219341
1,3,5-trimethoxy-2-(2,4,6-trimethoxyphenyl)benzene (PubChem CID 5219341) has the molecular formula C18H22O6 and a molecular weight of 334.37 g/mol. Its IUPAC name is 1,3,5-trimethoxy-2-(2,4,6-trimethoxyphenyl)benzene.
| Compound Name | 1,3,5-trimethoxy-2-(2,4,6-trimethoxyphenyl)benzene |
|---|---|
| PubChem CID | 5219341 |
| Molecular Formula | C18H22O6 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 1,3,5-trimethoxy-2-(2,4,6-trimethoxyphenyl)benzene |
| SMILES | COc1cc(OC)c(-c2c(OC)cc(OC)cc2OC)c(OC)c1 |
| InChI | InChI=1S/C18H22O6/c1-19-11-7-13(21-3)17(14(8-11)22-4)18-15(23-5)9-12(20-2)10-16(18)24-6/h7-10H,1-6H3 |
| InChIKey | PKTVMNKLPFVXBH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |