About N-benzyl-2,2-diethoxyethanamine
N-benzyl-2,2-diethoxyethanamine (PubChem CID 521961) has the molecular formula C13H21NO2
and a molecular weight of 223.32 g/mol. Its IUPAC name is N-benzyl-2,2-diethoxyethanamine.
Molecular Properties
| Compound Name | N-benzyl-2,2-diethoxyethanamine |
| PubChem CID | 521961 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | N-benzyl-2,2-diethoxyethanamine |
| SMILES | CCOC(CNCc1ccccc1)OCC |
| InChI | InChI=1S/C13H21NO2/c1-3-15-13(16-4-2)11-14-10-12-8-6-5-7-9-12/h5-9,13-14H,3-4,10-11H2,1-2H3 |
| InChIKey | SXFVQTYQHWRYOS-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-2,2-diethoxyethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2,2-diethoxyethanamine?
The IUPAC name of N-benzyl-2,2-diethoxyethanamine (CID 521961) is N-benzyl-2,2-diethoxyethanamine.
What is the SMILES notation for N-benzyl-2,2-diethoxyethanamine?
The canonical SMILES for N-benzyl-2,2-diethoxyethanamine is CCOC(CNCc1ccccc1)OCC.
What is the InChIKey of N-benzyl-2,2-diethoxyethanamine?
The InChIKey is SXFVQTYQHWRYOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO2/c1-3-15-13(16-4-2)11-14-10-12-8-6-5-7-9-12/h5-9,13-14H,3-4,10-11H2,1-2H3.
What are the key properties of N-benzyl-2,2-diethoxyethanamine?
N-benzyl-2,2-diethoxyethanamine has a molecular weight of 223.32 g/mol, XLogP of 2.18, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2,2-diethoxyethanamine is sourced from PubChem (CID 521961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).