About 7-chloroquinoline
7-chloroquinoline (PubChem CID 521963) has the molecular formula C9H6ClN
and a molecular weight of 163.61 g/mol. Its IUPAC name is 7-chloroquinoline.
Molecular Properties
| Compound Name | 7-chloroquinoline |
| PubChem CID | 521963 |
| Molecular Formula | C9H6ClN |
| Molecular Weight | 163.61 g/mol |
| Exact Mass | 163.02 |
| IUPAC Name | 7-chloroquinoline |
| SMILES | Clc1ccc2cccnc2c1 |
| InChI | InChI=1S/C9H6ClN/c10-8-4-3-7-2-1-5-11-9(7)6-8/h1-6H |
| InChIKey | QNGUPQRODVPRDC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.61 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-chloroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloroquinoline?
The IUPAC name of 7-chloroquinoline (CID 521963) is 7-chloroquinoline.
What is the SMILES notation for 7-chloroquinoline?
The canonical SMILES for 7-chloroquinoline is Clc1ccc2cccnc2c1.
What is the InChIKey of 7-chloroquinoline?
The InChIKey is QNGUPQRODVPRDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6ClN/c10-8-4-3-7-2-1-5-11-9(7)6-8/h1-6H.
What are the key properties of 7-chloroquinoline?
7-chloroquinoline has a molecular weight of 163.61 g/mol, XLogP of 2.89, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloroquinoline is sourced from PubChem (CID 521963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).