About 4-O-ethyl 1-O-methyl butanedioate
4-O-ethyl 1-O-methyl butanedioate (PubChem CID 522068) has the molecular formula C7H12O4
and a molecular weight of 160.17 g/mol. Its IUPAC name is 4-O-ethyl 1-O-methyl butanedioate.
Molecular Properties
| Compound Name | 4-O-ethyl 1-O-methyl butanedioate |
| PubChem CID | 522068 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 4-O-ethyl 1-O-methyl butanedioate |
| SMILES | CCOC(=O)CCC(=O)OC |
| InChI | InChI=1S/C7H12O4/c1-3-11-7(9)5-4-6(8)10-2/h3-5H2,1-2H3 |
| InChIKey | HXXRQBBSGZDQNP-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-O-ethyl 1-O-methyl butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-ethyl 1-O-methyl butanedioate?
The IUPAC name of 4-O-ethyl 1-O-methyl butanedioate (CID 522068) is 4-O-ethyl 1-O-methyl butanedioate.
What is the SMILES notation for 4-O-ethyl 1-O-methyl butanedioate?
The canonical SMILES for 4-O-ethyl 1-O-methyl butanedioate is CCOC(=O)CCC(=O)OC.
What is the InChIKey of 4-O-ethyl 1-O-methyl butanedioate?
The InChIKey is HXXRQBBSGZDQNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O4/c1-3-11-7(9)5-4-6(8)10-2/h3-5H2,1-2H3.
What are the key properties of 4-O-ethyl 1-O-methyl butanedioate?
4-O-ethyl 1-O-methyl butanedioate has a molecular weight of 160.17 g/mol, XLogP of 0.50, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-ethyl 1-O-methyl butanedioate is sourced from PubChem (CID 522068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).