About N-heptyl-N'-(2-methoxyethyl)butanediamide
N-heptyl-N'-(2-methoxyethyl)butanediamide (PubChem CID 5221406) has the molecular formula C14H28N2O3
and a molecular weight of 272.39 g/mol. Its IUPAC name is N-heptyl-N'-(2-methoxyethyl)butanediamide.
Molecular Properties
| Compound Name | N-heptyl-N'-(2-methoxyethyl)butanediamide |
| PubChem CID | 5221406 |
| Molecular Formula | C14H28N2O3 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | N-heptyl-N'-(2-methoxyethyl)butanediamide |
| SMILES | CCCCCCCNC(=O)CCC(=O)NCCOC |
| InChI | InChI=1S/C14H28N2O3/c1-3-4-5-6-7-10-15-13(17)8-9-14(18)16-11-12-19-2/h3-12H2,1-2H3,(H,15,17)(H,16,18) |
| InChIKey | DAEAMDSENMEVAN-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-heptyl-N'-(2-methoxyethyl)butanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-heptyl-N'-(2-methoxyethyl)butanediamide?
The IUPAC name of N-heptyl-N'-(2-methoxyethyl)butanediamide (CID 5221406) is N-heptyl-N'-(2-methoxyethyl)butanediamide.
What is the SMILES notation for N-heptyl-N'-(2-methoxyethyl)butanediamide?
The canonical SMILES for N-heptyl-N'-(2-methoxyethyl)butanediamide is CCCCCCCNC(=O)CCC(=O)NCCOC.
What is the InChIKey of N-heptyl-N'-(2-methoxyethyl)butanediamide?
The InChIKey is DAEAMDSENMEVAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N2O3/c1-3-4-5-6-7-10-15-13(17)8-9-14(18)16-11-12-19-2/h3-12H2,1-2H3,(H,15,17)(H,16,18).
What are the key properties of N-heptyl-N'-(2-methoxyethyl)butanediamide?
N-heptyl-N'-(2-methoxyethyl)butanediamide has a molecular weight of 272.39 g/mol, XLogP of 1.62, 12 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-heptyl-N'-(2-methoxyethyl)butanediamide is sourced from PubChem (CID 5221406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).